C15H26O — CID 22297710
(1S,4R,7S,11S)-3,3,7,11-tetramethyl-2-oxatricyclo[5.4.1.04,12]dodecane (PubChem CID 22297710) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (1S,4R,7S,11S)-3,3,7,11-tetramethyl-2-oxatricyclo[5.4.1.04,12]dodecane.
| Compound Name | (1S,4R,7S,11S)-3,3,7,11-tetramethyl-2-oxatricyclo[5.4.1.04,12]dodecane |
|---|---|
| PubChem CID | 22297710 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (1S,4R,7S,11S)-3,3,7,11-tetramethyl-2-oxatricyclo[5.4.1.04,12]dodecane |
| SMILES | C[C@H]1CCC[C@@]2(C)CCC3C2[C@H]1OC3(C)C |
| InChI | InChI=1S/C15H26O/c1-10-6-5-8-15(4)9-7-11-12(15)13(10)16-14(11,2)3/h10-13H,5-9H2,1-4H3/t10-,11?,12?,13-,15-/m0/s1 |
| InChIKey | GAZOZLXFXCZLCJ-LSWLGUJOSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |