C15H26O2 — CID 162912305
(1R,4R,7R,11S)-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodecan-7-ol (PubChem CID 162912305) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,4R,7R,11S)-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodecan-7-ol.
| Compound Name | (1R,4R,7R,11S)-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodecan-7-ol |
|---|---|
| PubChem CID | 162912305 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,4R,7R,11S)-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodecan-7-ol |
| SMILES | C[C@H]1CCC2C3[C@@H](CC[C@@]2(C)O)C(C)(C)O[C@@H]31 |
| InChI | InChI=1S/C15H26O2/c1-9-5-6-11-12-10(7-8-15(11,4)16)14(2,3)17-13(9)12/h9-13,16H,5-8H2,1-4H3/t9-,10+,11?,12?,13+,15+/m0/s1 |
| InChIKey | ADBBBTOFKUSIAE-BSHIKKFHSA-N |
| XLogP | 2.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |