C15H26O4 — CID 176680077
(1R,4R,14R)-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol (PubChem CID 176680077) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1R,4R,14R)-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol.
| Compound Name | (1R,4R,14R)-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol |
|---|---|
| PubChem CID | 176680077 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1R,4R,14R)-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol |
| SMILES | CC1CCC2[C@@H](C)CO[C@@H]3OC(C)(O)CCC1[C@@]23O |
| InChI | InChI=1S/C15H26O4/c1-9-4-5-11-10(2)8-18-13-15(11,17)12(9)6-7-14(3,16)19-13/h9-13,16-17H,4-8H2,1-3H3/t9?,10-,11?,12?,13+,14?,15-/m0/s1 |
| InChIKey | DBJDQVZUWZJQJF-UQMJSESQSA-N |
| XLogP | 1.89 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |