C19H30O8 — CID 147106606
4-[[(1R,3R,4R,5S,8R,9S,12S,14R)-12,14-dihydroxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxy]-4-oxobutanoic acid (PubChem CID 147106606) has the molecular formula C19H30O8 and a molecular weight of 386.44 g/mol. Its IUPAC name is 4-[[(1R,3R,4R,5S,8R,9S,12S,14R)-12,14-dihydroxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1R,3R,4R,5S,8R,9S,12S,14R)-12,14-dihydroxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 147106606 |
| Molecular Formula | C19H30O8 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[[(1R,3R,4R,5S,8R,9S,12S,14R)-12,14-dihydroxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxy]-4-oxobutanoic acid |
| SMILES | C[C@H]1[C@@H](OC(=O)CCC(=O)O)O[C@@H]2O[C@](C)(O)CC[C@H]3[C@H](C)CC[C@@H]1[C@@]23O |
| InChI | InChI=1S/C19H30O8/c1-10-4-5-13-11(2)16(25-15(22)7-6-14(20)21)26-17-19(13,24)12(10)8-9-18(3,23)27-17/h10-13,16-17,23-24H,4-9H2,1-3H3,(H,20,21)/t10-,11-,12+,13+,16+,17-,18+,19-/m1/s1 |
| InChIKey | BLRLKESEBFIMAI-HXMLZIBGSA-N |
| XLogP | 1.63 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |