C34H50O12 — CID 125113535
bis[(1R,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate (PubChem CID 125113535) has the molecular formula C34H50O12 and a molecular weight of 650.76 g/mol. Its IUPAC name is bis[(1R,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate.
| Compound Name | bis[(1R,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
|---|---|
| PubChem CID | 125113535 |
| Molecular Formula | C34H50O12 |
| Molecular Weight | 650.76 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | bis[(1R,4S,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)O[C@@H]2O[C@@H]3O[C@@]4(C)CC[C@H]5[C@H](C)CC[C@H]([C@H]2C)[C@@]35OO4)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@H]1[C@@]24OO3 |
| InChI | InChI=1S/C34H50O12/c1-17-7-9-23-19(3)27(39-29-33(23)21(17)13-15-31(5,41-29)43-45-33)37-25(35)11-12-26(36)38-28-20(4)24-10-8-18(2)22-14-16-32(6)42-30(40-28)34(22,24)46-44-32/h17-24,27-30H,7-16H2,1-6H3/t17-,18-,19-,20-,21+,22+,23-,24-,27-,28-,29-,30-,31-,32-,33-,34-/m1/s1 |
| InChIKey | OTIARJABKBSMJX-JBFYZCJWSA-N |
| XLogP | 5.27 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|