C41H60O14 — CID 122519376
bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4,8-dioxoundecanedioate (PubChem CID 122519376) has the molecular formula C41H60O14 and a molecular weight of 776.92 g/mol. Its IUPAC name is bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4,8-dioxoundecanedioate.
| Compound Name | bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4,8-dioxoundecanedioate |
|---|---|
| PubChem CID | 122519376 |
| Molecular Formula | C41H60O14 |
| Molecular Weight | 776.92 g/mol |
| Exact Mass | 776.40 |
| IUPAC Name | bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4,8-dioxoundecanedioate |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)CCCC(=O)CCC(=O)O[C@@H]2O[C@@H]3O[C@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C41H60O14/c1-22-10-14-30-24(3)34(48-36-40(30)28(22)18-20-38(5,50-36)52-54-40)46-32(44)16-12-26(42)8-7-9-27(43)13-17-33(45)47-35-25(4)31-15-11-23(2)29-19-21-39(6)51-37(49-35)41(29,31)55-53-39/h22-25,28-31,34-37H,7-21H2,1-6H3/t22-,23-,24-,25-,28+,29+,30+,31+,34-,35-,36-,37-,38+,39+,40-,41-/m1/s1 |
| InChIKey | YSPLQLAKVQEOMR-AXPBARBESA-N |
| XLogP | 6.36 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.92 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|