C21H32O8 — CID 11112405
6-oxo-6-[[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]hexanoic acid (PubChem CID 11112405) has the molecular formula C21H32O8 and a molecular weight of 412.48 g/mol. Its IUPAC name is 6-oxo-6-[[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]hexanoic acid.
| Compound Name | 6-oxo-6-[[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]hexanoic acid |
|---|---|
| PubChem CID | 11112405 |
| Molecular Formula | C21H32O8 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 6-oxo-6-[[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]hexanoic acid |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](OC(=O)CCCCC(=O)O)O[C@@H]3O[C@]4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C21H32O8/c1-12-8-9-15-13(2)18(25-17(24)7-5-4-6-16(22)23)26-19-21(15)14(12)10-11-20(3,27-19)28-29-21/h12-15,18-19H,4-11H2,1-3H3,(H,22,23)/t12-,13-,14?,15?,18-,19-,20+,21-/m1/s1 |
| InChIKey | GRGZEZOLCQBECC-JIAGZLRISA-N |
| XLogP | 3.38 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|