C23H35NO9 — CID 100855823
4-[[4-oxo-4-[[(1R,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid (PubChem CID 100855823) has the molecular formula C23H35NO9 and a molecular weight of 469.53 g/mol. Its IUPAC name is 4-[[4-oxo-4-[[(1R,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid.
| Compound Name | 4-[[4-oxo-4-[[(1R,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 100855823 |
| Molecular Formula | C23H35NO9 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 4-[[4-oxo-4-[[(1R,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoic acid |
| SMILES | C[C@@H]1[C@H](OC(=O)CCC(=O)NCCCC(=O)O)O[C@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@H]1[C@@]24OO3 |
| InChI | InChI=1S/C23H35NO9/c1-13-6-7-16-14(2)20(29-19(28)9-8-17(25)24-12-4-5-18(26)27)30-21-23(16)15(13)10-11-22(3,31-21)32-33-23/h13-16,20-21H,4-12H2,1-3H3,(H,24,25)(H,26,27)/t13-,14+,15+,16-,20-,21+,22-,23-/m1/s1 |
| InChIKey | UFYPJMIBQJQHGU-LPRAUIJXSA-N |
| XLogP | 2.50 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|