C29H46N2O10 — CID 98122552
(2S)-4-methyl-2-[4-[[4-oxo-4-[[(1S,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoylamino]pentanoic acid (PubChem CID 98122552) has the molecular formula C29H46N2O10 and a molecular weight of 582.69 g/mol. Its IUPAC name is (2S)-4-methyl-2-[4-[[4-oxo-4-[[(1S,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoylamino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[4-[[4-oxo-4-[[(1S,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 98122552 |
| Molecular Formula | C29H46N2O10 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | (2S)-4-methyl-2-[4-[[4-oxo-4-[[(1S,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoylamino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CCCNC(=O)CCC(=O)O[C@@H]1O[C@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@H]([C@@H]1C)[C@@]24OO3)C(=O)O |
| InChI | InChI=1S/C29H46N2O10/c1-16(2)15-21(25(35)36)31-23(33)7-6-14-30-22(32)10-11-24(34)37-26-18(4)20-9-8-17(3)19-12-13-28(5)39-27(38-26)29(19,20)41-40-28/h16-21,26-27H,6-15H2,1-5H3,(H,30,32)(H,31,33)(H,35,36)/t17-,18+,19+,20-,21+,26-,27+,28+,29-/m1/s1 |
| InChIKey | UKEGJFCNVSBHRO-DIICFBBJSA-N |
| XLogP | 3.03 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|