C28H44N2O10 — CID 98452026
(2S)-3-methyl-2-[4-[[4-oxo-4-[[(1S,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoylamino]butanoic acid (PubChem CID 98452026) has the molecular formula C28H44N2O10 and a molecular weight of 568.66 g/mol. Its IUPAC name is (2S)-3-methyl-2-[4-[[4-oxo-4-[[(1S,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoylamino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[4-[[4-oxo-4-[[(1S,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 98452026 |
| Molecular Formula | C28H44N2O10 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | (2S)-3-methyl-2-[4-[[4-oxo-4-[[(1S,4S,5R,8R,9S,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]butanoylamino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCNC(=O)CCC(=O)O[C@@H]1O[C@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@H]([C@@H]1C)[C@@]24OO3)C(=O)O |
| InChI | InChI=1S/C28H44N2O10/c1-15(2)23(24(34)35)30-21(32)7-6-14-29-20(31)10-11-22(33)36-25-17(4)19-9-8-16(3)18-12-13-27(5)38-26(37-25)28(18,19)40-39-27/h15-19,23,25-26H,6-14H2,1-5H3,(H,29,31)(H,30,32)(H,34,35)/t16-,17+,18+,19-,23+,25-,26+,27+,28-/m1/s1 |
| InChIKey | BGYZZUPIXBTHQV-GGGVACPFSA-N |
| XLogP | 2.64 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|