C25H39NO9 — CID 126505471
6-[[4-oxo-4-[[(1R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]hexanoic acid (PubChem CID 126505471) has the molecular formula C25H39NO9 and a molecular weight of 497.59 g/mol. Its IUPAC name is 6-[[4-oxo-4-[[(1R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]hexanoic acid.
| Compound Name | 6-[[4-oxo-4-[[(1R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 126505471 |
| Molecular Formula | C25H39NO9 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 6-[[4-oxo-4-[[(1R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]hexanoic acid |
| SMILES | CC1CCC2C(C)[C@H](OC(=O)CCC(=O)NCCCCCC(=O)O)O[C@@H]3O[C@@]4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C25H39NO9/c1-15-8-9-18-16(2)22(32-23-25(18)17(15)12-13-24(3,33-23)34-35-25)31-21(30)11-10-19(27)26-14-6-4-5-7-20(28)29/h15-18,22-23H,4-14H2,1-3H3,(H,26,27)(H,28,29)/t15?,16?,17?,18?,22-,23-,24-,25-/m1/s1 |
| InChIKey | XPEVAAIZVBFUGG-FXSNQQNISA-N |
| XLogP | 3.28 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|