C23H38O6 — CID 86574493
[(5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] octanoate (PubChem CID 86574493) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] octanoate.
| Compound Name | [(5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] octanoate |
|---|---|
| PubChem CID | 86574493 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | [(5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1O[C@@H]2OC3(C)CCC4[C@H](C)CCC([C@H]1C)[C@]42OO3 |
| InChI | InChI=1S/C23H38O6/c1-5-6-7-8-9-10-19(24)25-20-16(3)18-12-11-15(2)17-13-14-22(4)27-21(26-20)23(17,18)29-28-22/h15-18,20-21H,5-14H2,1-4H3/t15-,16-,17?,18?,20?,21-,22?,23-/m1/s1 |
| InChIKey | NZAVLYDASSAFQD-LHWRBSQESA-N |
| XLogP | 5.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|