C16H28O5 — CID 144674207
(1R,3S,4R,5S,8R,9S,14R)-3-methoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol (PubChem CID 144674207) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is (1R,3S,4R,5S,8R,9S,14R)-3-methoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol.
| Compound Name | (1R,3S,4R,5S,8R,9S,14R)-3-methoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol |
|---|---|
| PubChem CID | 144674207 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (1R,3S,4R,5S,8R,9S,14R)-3-methoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol |
| SMILES | CO[C@H]1O[C@@H]2OC(C)(O)CC[C@H]3[C@H](C)CC[C@@H]([C@H]1C)[C@@]23O |
| InChI | InChI=1S/C16H28O5/c1-9-5-6-12-10(2)13(19-4)20-14-16(12,18)11(9)7-8-15(3,17)21-14/h9-14,17-18H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15?,16-/m1/s1 |
| InChIKey | IIVKJMNUWGOEST-GXTLMGRASA-N |
| XLogP | 1.86 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |