C31H46O11 — CID 24850614
bis[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] carbonate (PubChem CID 24850614) has the molecular formula C31H46O11 and a molecular weight of 594.70 g/mol. Its IUPAC name is bis[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] carbonate.
| Compound Name | bis[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] carbonate |
|---|---|
| PubChem CID | 24850614 |
| Molecular Formula | C31H46O11 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | bis[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] carbonate |
| SMILES | C[C@H]1[C@@H](OC(=O)O[C@H]2O[C@@H]3O[C@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C31H46O11/c1-15-7-9-21-17(3)23(33-25-30(21)19(15)11-13-28(5,37-25)39-41-30)35-27(32)36-24-18(4)22-10-8-16(2)20-12-14-29(6)38-26(34-24)31(20,22)42-40-29/h15-26H,7-14H2,1-6H3/t15-,16-,17-,18-,19+,20+,21+,22+,23-,24-,25-,26-,28+,29+,30-,31-/m1/s1 |
| InChIKey | GXCFZLKBYVLKBV-WMINLCEASA-N |
| XLogP | 5.56 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|