C18H23F5O6 — CID 72734447
[(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 72734447) has the molecular formula C18H23F5O6 and a molecular weight of 430.37 g/mol. Its IUPAC name is [(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 72734447 |
| Molecular Formula | C18H23F5O6 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [(1S,4S,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](OC(=O)C(F)(F)C(F)(F)F)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C18H23F5O6/c1-8-4-5-11-9(2)12(25-13(24)17(19,20)18(21,22)23)26-14-16(11)10(8)6-7-15(3,27-14)28-29-16/h8-12,14H,4-7H2,1-3H3/t8-,9-,10+,11?,12+,14-,15+,16-/m1/s1 |
| InChIKey | SHXMSGYZFIKDSY-OMRBDHEYSA-N |
| XLogP | 3.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|