C17H25F3O5 — CID 121360142
(1S,5R,9R,12R,13R)-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 121360142) has the molecular formula C17H25F3O5 and a molecular weight of 366.38 g/mol. Its IUPAC name is (1S,5R,9R,12R,13R)-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,5R,9R,12R,13R)-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 121360142 |
| Molecular Formula | C17H25F3O5 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (1S,5R,9R,12R,13R)-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@H]1C(OCC(F)(F)F)O[C@@H]2O[C@]3(C)CCC4[C@H](C)CCC1[C@]42OO3 |
| InChI | InChI=1S/C17H25F3O5/c1-9-4-5-12-10(2)13(21-8-16(18,19)20)22-14-17(12)11(9)6-7-15(3,23-14)24-25-17/h9-14H,4-8H2,1-3H3/t9-,10-,11?,12?,13?,14-,15+,17-/m1/s1 |
| InChIKey | GTWREXBWRJAYAW-SZRFKBGPSA-N |
| XLogP | 3.77 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|