C19H32O5 — CID 177090836
(4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-[(2-methylpropan-2-yl)oxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 177090836) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is (4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-[(2-methylpropan-2-yl)oxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-[(2-methylpropan-2-yl)oxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 177090836 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-10-[(2-methylpropan-2-yl)oxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@H]1[C@H](OC(C)(C)C)O[C@@H]2OC3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C19H32O5/c1-11-7-8-14-12(2)15(21-17(3,4)5)20-16-19(14)13(11)9-10-18(6,22-16)23-24-19/h11-16H,7-10H2,1-6H3/t11-,12-,13+,14+,15+,16-,18?,19-/m1/s1 |
| InChIKey | PIIQBEAIJBJGLJ-FWJJHBNZSA-N |
| XLogP | 4.01 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|