C18H24F6O5 — CID 10622697
(1R,4S,5R,8S,9S,10R,12R,13R)-10-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10622697) has the molecular formula C18H24F6O5 and a molecular weight of 434.37 g/mol. Its IUPAC name is (1R,4S,5R,8S,9S,10R,12R,13R)-10-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8S,9S,10R,12R,13R)-10-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10622697 |
| Molecular Formula | C18H24F6O5 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (1R,4S,5R,8S,9S,10R,12R,13R)-10-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1[C@H](OC(C(F)(F)F)C(F)(F)F)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C18H24F6O5/c1-8-4-5-11-9(2)12(25-13(17(19,20)21)18(22,23)24)26-14-16(11)10(8)6-7-15(3,27-14)28-29-16/h8-14H,4-7H2,1-3H3/t8-,9+,10+,11+,12-,14-,15-,16-/m1/s1 |
| InChIKey | IIVIMLMUCQPYLB-PCGCTMMYSA-N |
| XLogP | 4.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|