C24H31F3O5 — CID 10366791
(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-10-[(1R)-1-[4-(trifluoromethyl)phenyl]ethoxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10366791) has the molecular formula C24H31F3O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is (1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-10-[(1R)-1-[4-(trifluoromethyl)phenyl]ethoxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-10-[(1R)-1-[4-(trifluoromethyl)phenyl]ethoxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10366791 |
| Molecular Formula | C24H31F3O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-10-[(1R)-1-[4-(trifluoromethyl)phenyl]ethoxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](O[C@H](C)c3ccc(C(F)(F)F)cc3)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C24H31F3O5/c1-13-5-10-19-14(2)20(28-15(3)16-6-8-17(9-7-16)24(25,26)27)29-21-23(19)18(13)11-12-22(4,30-21)31-32-23/h6-9,13-15,18-21H,5,10-12H2,1-4H3/t13-,14-,15-,18+,19?,20+,21-,22-,23-/m1/s1 |
| InChIKey | OIQGKZALYSLNLA-VPMLGLFQSA-N |
| XLogP | 5.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|