C20H29F3O7 — CID 54494540
ethyl 3,3,3-trifluoro-2-[[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propanoate (PubChem CID 54494540) has the molecular formula C20H29F3O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propanoate |
|---|---|
| PubChem CID | 54494540 |
| Molecular Formula | C20H29F3O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propanoate |
| SMILES | CCOC(=O)C(OC1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)C(F)(F)F |
| InChI | InChI=1S/C20H29F3O7/c1-5-25-15(24)14(20(21,22)23)26-16-11(3)13-7-6-10(2)12-8-9-18(4)28-17(27-16)19(12,13)30-29-18/h10-14,16-17H,5-9H2,1-4H3/t10-,11-,12+,13+,14?,16?,17-,18-,19-/m1/s1 |
| InChIKey | XYCXAHCXLSZRQC-RGSYIBFKSA-N |
| XLogP | 3.70 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|