C19H26F6O5 — CID 10765862
(1R,4S,5R,8S,9S,10R,12R,13R)-10-(2,2,3,4,4,4-hexafluorobutoxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10765862) has the molecular formula C19H26F6O5 and a molecular weight of 448.40 g/mol. Its IUPAC name is (1R,4S,5R,8S,9S,10R,12R,13R)-10-(2,2,3,4,4,4-hexafluorobutoxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8S,9S,10R,12R,13R)-10-(2,2,3,4,4,4-hexafluorobutoxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10765862 |
| Molecular Formula | C19H26F6O5 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (1R,4S,5R,8S,9S,10R,12R,13R)-10-(2,2,3,4,4,4-hexafluorobutoxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1[C@H](OCC(F)(F)C(F)C(F)(F)F)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C19H26F6O5/c1-9-4-5-12-10(2)13(26-8-17(21,22)14(20)19(23,24)25)27-15-18(12)11(9)6-7-16(3,28-15)29-30-18/h9-15H,4-8H2,1-3H3/t9-,10+,11+,12+,13-,14?,15-,16-,18-/m1/s1 |
| InChIKey | DFBXOAXDWYYGMV-AEKFRTGWSA-N |
| XLogP | 4.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|