C18H30O6 — CID 10472551
1-[[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propan-2-ol (PubChem CID 10472551) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is 1-[[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propan-2-ol.
| Compound Name | 1-[[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 10472551 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1-[[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propan-2-ol |
| SMILES | CC(O)CO[C@@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C18H30O6/c1-10-5-6-14-12(3)15(20-9-11(2)19)21-16-18(14)13(10)7-8-17(4,22-16)23-24-18/h10-16,19H,5-9H2,1-4H3/t10-,11?,12-,13+,14+,15-,16-,17-,18-/m1/s1 |
| InChIKey | JNQNSYKNZHUDFC-QTYVDUQZSA-N |
| XLogP | 2.59 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|