C19H30O7 — CID 140718365
ethyl 2-[[(5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]acetate (PubChem CID 140718365) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is ethyl 2-[[(5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]acetate |
|---|---|
| PubChem CID | 140718365 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | ethyl 2-[[(5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]acetate |
| SMILES | CCOC(=O)COC1O[C@@H]2OC3(C)CCC4[C@H](C)CCC([C@H]1C)[C@]42OO3 |
| InChI | InChI=1S/C19H30O7/c1-5-21-15(20)10-22-16-12(3)14-7-6-11(2)13-8-9-18(4)24-17(23-16)19(13,14)26-25-18/h11-14,16-17H,5-10H2,1-4H3/t11-,12-,13?,14?,16?,17-,18?,19-/m1/s1 |
| InChIKey | VADVVZYGPHZHGC-JUGISBRESA-N |
| XLogP | 2.77 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|