C19H28O9 — CID 147997164
2-[2-oxo-2-[[(1R,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethoxy]acetic acid (PubChem CID 147997164) has the molecular formula C19H28O9 and a molecular weight of 400.42 g/mol. Its IUPAC name is 2-[2-oxo-2-[[(1R,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethoxy]acetic acid.
| Compound Name | 2-[2-oxo-2-[[(1R,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 147997164 |
| Molecular Formula | C19H28O9 |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[2-oxo-2-[[(1R,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethoxy]acetic acid |
| SMILES | C[C@H]1C(OC(=O)COCC(=O)O)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CCC1[C@@]24OO3 |
| InChI | InChI=1S/C19H28O9/c1-10-4-5-13-11(2)16(24-15(22)9-23-8-14(20)21)25-17-19(13)12(10)6-7-18(3,26-17)27-28-19/h10-13,16-17H,4-9H2,1-3H3,(H,20,21)/t10-,11-,12+,13?,16?,17-,18-,19-/m1/s1 |
| InChIKey | IWFWHPGWLNTVPL-DMZZSMJPSA-N |
| XLogP | 1.84 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|