C25H36O5 — CID 140718359
(5R,9R,12R,13R)-10-(4-tert-butylphenoxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 140718359) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (5R,9R,12R,13R)-10-(4-tert-butylphenoxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (5R,9R,12R,13R)-10-(4-tert-butylphenoxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 140718359 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (5R,9R,12R,13R)-10-(4-tert-butylphenoxy)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@H]1C(Oc2ccc(C(C)(C)C)cc2)O[C@@H]2OC3(C)CCC4[C@H](C)CCC1[C@]42OO3 |
| InChI | InChI=1S/C25H36O5/c1-15-7-12-20-16(2)21(26-18-10-8-17(9-11-18)23(3,4)5)27-22-25(20)19(15)13-14-24(6,28-22)29-30-25/h8-11,15-16,19-22H,7,12-14H2,1-6H3/t15-,16-,19?,20?,21?,22-,24?,25-/m1/s1 |
| InChIKey | PPVDUNCSQCIQFS-ANZNSXNBSA-N |
| XLogP | 5.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|