C28H37NO6 — CID 118654532
(E)-1-pyrrolidin-1-yl-3-[4-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenyl]prop-2-en-1-one (PubChem CID 118654532) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is (E)-1-pyrrolidin-1-yl-3-[4-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-pyrrolidin-1-yl-3-[4-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118654532 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | (E)-1-pyrrolidin-1-yl-3-[4-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]phenyl]prop-2-en-1-one |
| SMILES | C[C@H]1[C@@H](Oc2ccc(/C=C/C(=O)N3CCCC3)cc2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C28H37NO6/c1-18-6-12-23-19(2)25(32-26-28(23)22(18)14-15-27(3,33-26)34-35-28)31-21-10-7-20(8-11-21)9-13-24(30)29-16-4-5-17-29/h7-11,13,18-19,22-23,25-26H,4-6,12,14-17H2,1-3H3/b13-9+/t18-,19-,22+,23+,25+,26-,27+,28-/m1/s1 |
| InChIKey | REGCXXGVCHWEHK-QUFRTKCDSA-N |
| XLogP | 4.91 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|