C26H35NO7 — CID 72944912
1-morpholin-4-yl-2-[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]ethanone (PubChem CID 72944912) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]ethanone.
| Compound Name | 1-morpholin-4-yl-2-[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]ethanone |
|---|---|
| PubChem CID | 72944912 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 1-morpholin-4-yl-2-[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]ethanone |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](Oc3ccc(CC(=O)N4CCOCC4)cc3)O[C@@H]3O[C@]4(C)CC1[C@@]23OO4 |
| InChI | InChI=1S/C26H35NO7/c1-16-4-9-20-17(2)23(31-24-26(20)21(16)15-25(3,32-24)33-34-26)30-19-7-5-18(6-8-19)14-22(28)27-10-12-29-13-11-27/h5-8,16-17,20-21,23-24H,4,9-15H2,1-3H3/t16-,17-,20?,21?,23+,24-,25+,26+/m1/s1 |
| InChIKey | ODMKDEDZXIOTOD-QGQQTTBLSA-N |
| XLogP | 3.28 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|