C31H46N2O5 — CID 72944606
4-piperidin-1-yl-1-[[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]methyl]piperidine (PubChem CID 72944606) has the molecular formula C31H46N2O5 and a molecular weight of 526.72 g/mol. Its IUPAC name is 4-piperidin-1-yl-1-[[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]methyl]piperidine.
| Compound Name | 4-piperidin-1-yl-1-[[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 72944606 |
| Molecular Formula | C31H46N2O5 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | 4-piperidin-1-yl-1-[[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]methyl]piperidine |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](Oc3ccc(CN4CCC(N5CCCCC5)CC4)cc3)O[C@@H]3O[C@]4(C)CC1[C@@]23OO4 |
| InChI | InChI=1S/C31H46N2O5/c1-21-7-12-26-22(2)28(35-29-31(26)27(21)19-30(3,36-29)37-38-31)34-25-10-8-23(9-11-25)20-32-17-13-24(14-18-32)33-15-5-4-6-16-33/h8-11,21-22,24,26-29H,4-7,12-20H2,1-3H3/t21-,22-,26?,27?,28+,29-,30+,31+/m1/s1 |
| InChIKey | MNNYIHMMPPZONV-VURGCYMMSA-N |
| XLogP | 5.33 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|