C28H41NO5 — CID 10600486
1-[[4-[[(1R,4S,5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]phenyl]methyl]piperidine (PubChem CID 10600486) has the molecular formula C28H41NO5 and a molecular weight of 471.64 g/mol. Its IUPAC name is 1-[[4-[[(1R,4S,5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]phenyl]methyl]piperidine.
| Compound Name | 1-[[4-[[(1R,4S,5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 10600486 |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | 1-[[4-[[(1R,4S,5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]phenyl]methyl]piperidine |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](OCc3ccc(CN4CCCCC4)cc3)OC3O[C@@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C28H41NO5/c1-19-7-12-24-20(2)25(31-26-28(24)23(19)13-14-27(3,32-26)33-34-28)30-18-22-10-8-21(9-11-22)17-29-15-5-4-6-16-29/h8-11,19-20,23-26H,4-7,12-18H2,1-3H3/t19-,20-,23+,24?,25+,26?,27-,28-/m1/s1 |
| InChIKey | QBDZNAOQIOKONC-WZHQQKBQSA-N |
| XLogP | 5.40 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|