C27H38O8 — CID 11677572
ethyl 2-[4-[[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]phenoxy]propanoate (PubChem CID 11677572) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is ethyl 2-[4-[[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]phenoxy]propanoate.
| Compound Name | ethyl 2-[4-[[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 11677572 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | ethyl 2-[4-[[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1ccc(CO[C@H]2O[C@@H]3O[C@]4(C)CCC5[C@H](C)CCC([C@H]2C)[C@]53OO4)cc1 |
| InChI | InChI=1S/C27H38O8/c1-6-29-23(28)18(4)31-20-10-8-19(9-11-20)15-30-24-17(3)22-12-7-16(2)21-13-14-26(5)33-25(32-24)27(21,22)35-34-26/h8-11,16-18,21-22,24-25H,6-7,12-15H2,1-5H3/t16-,17-,18?,21?,22?,24+,25-,26+,27-/m1/s1 |
| InChIKey | SPHZJKRFSMQHLP-CIWSAZMRSA-N |
| XLogP | 4.74 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|