C22H31N3O6 — CID 58983355
5-[[(1S,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]pyridine-2-carbohydrazide (PubChem CID 58983355) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 5-[[(1S,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]pyridine-2-carbohydrazide.
| Compound Name | 5-[[(1S,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 58983355 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 5-[[(1S,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]pyridine-2-carbohydrazide |
| SMILES | C[C@H]1C(OCc2ccc(C(=O)NN)nc2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CCC1[C@@]24OO3 |
| InChI | InChI=1S/C22H31N3O6/c1-12-4-6-16-13(2)19(27-11-14-5-7-17(24-10-14)18(26)25-23)28-20-22(16)15(12)8-9-21(3,29-20)30-31-22/h5,7,10,12-13,15-16,19-20H,4,6,8-9,11,23H2,1-3H3,(H,25,26)/t12-,13-,15+,16?,19?,20-,21+,22-/m1/s1 |
| InChIKey | VGJDHAJGPPLJCB-BKNCLNQVSA-N |
| XLogP | 2.41 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|