C27H38O8 — CID 150216261
methyl 3-[4-[2-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethoxy]phenyl]propanoate (PubChem CID 150216261) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is methyl 3-[4-[2-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[2-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 150216261 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | methyl 3-[4-[2-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCCO[C@H]2O[C@@H]3O[C@@]4(C)CCC5[C@H](C)CC[C@@H]([C@H]2C)[C@]53OO4)cc1 |
| InChI | InChI=1S/C27H38O8/c1-17-5-11-22-18(2)24(32-25-27(22)21(17)13-14-26(3,33-25)34-35-27)31-16-15-30-20-9-6-19(7-10-20)8-12-23(28)29-4/h6-7,9-10,17-18,21-22,24-25H,5,8,11-16H2,1-4H3/t17-,18-,21?,22+,24+,25-,26-,27-/m1/s1 |
| InChIKey | FSNUAENQKIPWOW-RKHHPKAASA-N |
| XLogP | 4.40 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|