C28H38O10 — CID 59456122
1-O-[2-(3-hydroxy-4-methoxyphenyl)ethyl] 4-O-[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate (PubChem CID 59456122) has the molecular formula C28H38O10 and a molecular weight of 534.60 g/mol. Its IUPAC name is 1-O-[2-(3-hydroxy-4-methoxyphenyl)ethyl] 4-O-[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate.
| Compound Name | 1-O-[2-(3-hydroxy-4-methoxyphenyl)ethyl] 4-O-[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
|---|---|
| PubChem CID | 59456122 |
| Molecular Formula | C28H38O10 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 1-O-[2-(3-hydroxy-4-methoxyphenyl)ethyl] 4-O-[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
| SMILES | COc1ccc(CCOC(=O)CCC(=O)O[C@@H]2O[C@@H]3O[C@]4(C)CC[C@H]5[C@H](C)CCC([C@H]2C)C35OO4)cc1O |
| InChI | InChI=1S/C28H38O10/c1-16-5-7-20-17(2)25(35-26-28(20)19(16)11-13-27(3,36-26)37-38-28)34-24(31)10-9-23(30)33-14-12-18-6-8-22(32-4)21(29)15-18/h6,8,15-17,19-20,25-26,29H,5,7,9-14H2,1-4H3/t16-,17-,19+,20?,25-,26-,27+,28?/m1/s1 |
| InChIKey | RCFXAYLKIZDMNC-QKDKRIACSA-N |
| XLogP | 4.02 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|