C27H37NO9 — CID 124917879
[(1R,4R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoate (PubChem CID 124917879) has the molecular formula C27H37NO9 and a molecular weight of 519.59 g/mol. Its IUPAC name is [(1R,4R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoate.
| Compound Name | [(1R,4R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 124917879 |
| Molecular Formula | C27H37NO9 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | [(1R,4R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoate |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)NCCc2ccc(O)c(O)c2)O[C@@H]2O[C@@]3(C)CC[C@@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C27H37NO9/c1-15-4-6-19-16(2)24(34-25-27(19)18(15)10-12-26(3,35-25)36-37-27)33-23(32)9-8-22(31)28-13-11-17-5-7-20(29)21(30)14-17/h5,7,14-16,18-19,24-25,29-30H,4,6,8-13H2,1-3H3,(H,28,31)/t15-,16-,18-,19+,24-,25-,26-,27-/m1/s1 |
| InChIKey | LBQUZEGPLOWJBH-WZRPYEHJSA-N |
| XLogP | 3.29 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|