C26H36O8 — CID 151838931
methyl 3-[3-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propoxy]benzoate (PubChem CID 151838931) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is methyl 3-[3-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propoxy]benzoate.
| Compound Name | methyl 3-[3-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propoxy]benzoate |
|---|---|
| PubChem CID | 151838931 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | methyl 3-[3-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCCCO[C@H]2O[C@@H]3O[C@@]4(C)CCC5[C@H](C)CC[C@@H]([C@H]2C)[C@]53OO4)c1 |
| InChI | InChI=1S/C26H36O8/c1-16-9-10-21-17(2)23(31-24-26(21)20(16)11-12-25(3,32-24)33-34-26)30-14-6-13-29-19-8-5-7-18(15-19)22(27)28-4/h5,7-8,15-17,20-21,23-24H,6,9-14H2,1-4H3/t16-,17-,20?,21+,23+,24-,25-,26-/m1/s1 |
| InChIKey | SGGCGUOMDXFCCP-WOONIYHLSA-N |
| XLogP | 4.47 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|