C26H36O8 — CID 176697257
2-methoxy-4-[3-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl]benzoic acid (PubChem CID 176697257) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-methoxy-4-[3-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl]benzoic acid.
| Compound Name | 2-methoxy-4-[3-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl]benzoic acid |
|---|---|
| PubChem CID | 176697257 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 2-methoxy-4-[3-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl]benzoic acid |
| SMILES | COc1cc(CCCO[C@H]2O[C@@H]3O[C@@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)ccc1C(=O)O |
| InChI | InChI=1S/C26H36O8/c1-15-7-10-20-16(2)23(31-24-26(20)19(15)11-12-25(3,32-24)33-34-26)30-13-5-6-17-8-9-18(22(27)28)21(14-17)29-4/h8-9,14-16,19-20,23-24H,5-7,10-13H2,1-4H3,(H,27,28)/t15-,16-,19+,20+,23+,24-,25-,26-/m1/s1 |
| InChIKey | VNELXMFBGJQBHF-UPRDFIFGSA-N |
| XLogP | 4.55 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|