C23H32O5 — CID 121356288
(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-10-[(4-methylphenyl)methoxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 121356288) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is (1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-10-[(4-methylphenyl)methoxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-10-[(4-methylphenyl)methoxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 121356288 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-10-[(4-methylphenyl)methoxy]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | Cc1ccc(CO[C@H]2O[C@@H]3O[C@]4(C)CCC5[C@H](C)CCC([C@H]2C)[C@]53OO4)cc1 |
| InChI | InChI=1S/C23H32O5/c1-14-5-8-17(9-6-14)13-24-20-16(3)19-10-7-15(2)18-11-12-22(4)26-21(25-20)23(18,19)28-27-22/h5-6,8-9,15-16,18-21H,7,10-13H2,1-4H3/t15-,16-,18?,19?,20+,21-,22+,23-/m1/s1 |
| InChIKey | AMFMLNPRIFBHAC-ZGLBPWDXSA-N |
| XLogP | 4.72 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|