C27H40N2O6 — CID 24884723
N-(4-aminobutyl)-4-[[(1S,5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzamide (PubChem CID 24884723) has the molecular formula C27H40N2O6 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-[[(1S,5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzamide.
| Compound Name | N-(4-aminobutyl)-4-[[(1S,5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzamide |
|---|---|
| PubChem CID | 24884723 |
| Molecular Formula | C27H40N2O6 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | N-(4-aminobutyl)-4-[[(1S,5R,9R,10S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzamide |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](OCc3ccc(C(=O)NCCCCN)cc3)OC3O[C@]4(C)CCC1[C@]32OO4 |
| InChI | InChI=1S/C27H40N2O6/c1-17-6-11-22-18(2)24(32-25-27(22)21(17)12-13-26(3,33-25)34-35-27)31-16-19-7-9-20(10-8-19)23(30)29-15-5-4-14-28/h7-10,17-18,21-22,24-25H,4-6,11-16,28H2,1-3H3,(H,29,30)/t17-,18-,21?,22?,24+,25?,26+,27-/m1/s1 |
| InChIKey | JUASLRZQCLRMIH-AHPRTFMGSA-N |
| XLogP | 3.88 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|