C29H44N2O9 — CID 10076607
2,6-diaminohexanoic acid;4-[[(1S,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid (PubChem CID 10076607) has the molecular formula C29H44N2O9 and a molecular weight of 564.68 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;4-[[(1S,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid.
| Compound Name | 2,6-diaminohexanoic acid;4-[[(1S,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 10076607 |
| Molecular Formula | C29H44N2O9 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 2,6-diaminohexanoic acid;4-[[(1S,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](OCc3ccc(C(=O)O)cc3)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@@]23OO4.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C23H30O7.C6H14N2O2/c1-13-4-9-18-14(2)20(26-12-15-5-7-16(8-6-15)19(24)25)27-21-23(18)17(13)10-11-22(3,28-21)29-30-23;7-4-2-1-3-5(8)6(9)10/h5-8,13-14,17-18,20-21H,4,9-12H2,1-3H3,(H,24,25);5H,1-4,7-8H2,(H,9,10)/t13-,14-,17+,18?,20+,21-,22+,23-;/m1./s1 |
| InChIKey | WAUSEHLWLUQFTQ-MKVXBNLMSA-N |
| XLogP | 3.64 |
| TPSA | 172.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|