C24H32O8 — CID 176697091
3-methoxy-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid (PubChem CID 176697091) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is 3-methoxy-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid.
| Compound Name | 3-methoxy-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 176697091 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-methoxy-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1CO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C24H32O8/c1-13-5-8-18-14(2)21(28-12-16-7-6-15(20(25)26)11-19(16)27-4)29-22-24(18)17(13)9-10-23(3,30-22)31-32-24/h6-7,11,13-14,17-18,21-22H,5,8-10,12H2,1-4H3,(H,25,26)/t13-,14-,17+,18+,21+,22-,23-,24-/m1/s1 |
| InChIKey | JZBGZCLQUHVKKA-TVZHZPGDSA-N |
| XLogP | 4.12 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|