C22H31NO7 — CID 164618904
2-(hydroxymethyl)-6-[[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]-1H-pyridin-4-one (PubChem CID 164618904) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]-1H-pyridin-4-one.
| Compound Name | 2-(hydroxymethyl)-6-[[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 164618904 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-(hydroxymethyl)-6-[[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]-1H-pyridin-4-one |
| SMILES | C[C@H]1[C@H](OCc2cc(=O)cc(CO)[nH]2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C22H31NO7/c1-12-4-5-18-13(2)19(26-11-15-9-16(25)8-14(10-24)23-15)27-20-22(18)17(12)6-7-21(3,28-20)29-30-22/h8-9,12-13,17-20,24H,4-7,10-11H2,1-3H3,(H,23,25)/t12-,13-,17+,18+,19-,20-,21+,22-/m1/s1 |
| InChIKey | XHJPSCYZOQPQMT-FVYTYISNSA-N |
| XLogP | 2.59 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|