C28H39NO10 — CID 172986794
2-[(E)-[3-methoxy-4-[3-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propoxy]phenyl]methylideneamino]oxyacetic acid (PubChem CID 172986794) has the molecular formula C28H39NO10 and a molecular weight of 549.62 g/mol. Its IUPAC name is 2-[(E)-[3-methoxy-4-[3-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propoxy]phenyl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-[3-methoxy-4-[3-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propoxy]phenyl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 172986794 |
| Molecular Formula | C28H39NO10 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 2-[(E)-[3-methoxy-4-[3-[[(1R,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propoxy]phenyl]methylideneamino]oxyacetic acid |
| SMILES | COc1cc(/C=N/OCC(=O)O)ccc1OCCCO[C@H]1O[C@@H]2O[C@@]3(C)CCC4[C@H](C)CC[C@@H]([C@H]1C)[C@]42OO3 |
| InChI | InChI=1S/C28H39NO10/c1-17-6-8-21-18(2)25(36-26-28(21)20(17)10-11-27(3,37-26)38-39-28)34-13-5-12-33-22-9-7-19(14-23(22)32-4)15-29-35-16-24(30)31/h7,9,14-15,17-18,20-21,25-26H,5-6,8,10-13,16H2,1-4H3,(H,30,31)/b29-15+/t17-,18-,20?,21+,25+,26-,27-,28-/m1/s1 |
| InChIKey | SRKBOAINKRZLPK-UJWHRJJGSA-N |
| XLogP | 4.12 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|