C23H39NO6S — CID 10321885
S-[3-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl] N,N-diethylcarbamothioate (PubChem CID 10321885) has the molecular formula C23H39NO6S and a molecular weight of 457.63 g/mol. Its IUPAC name is S-[3-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl] N,N-diethylcarbamothioate.
| Compound Name | S-[3-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl] N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 10321885 |
| Molecular Formula | C23H39NO6S |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | S-[3-[[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]propyl] N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=O)SCCCO[C@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C23H39NO6S/c1-6-24(7-2)21(25)31-14-8-13-26-19-16(4)18-10-9-15(3)17-11-12-22(5)28-20(27-19)23(17,18)30-29-22/h15-20H,6-14H2,1-5H3/t15-,16-,17+,18+,19+,20-,22+,23-/m1/s1 |
| InChIKey | LTSBSYOVBZWOCW-WAIGYISSSA-N |
| XLogP | 4.80 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|