C25H43NO6S — CID 71737047
5-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]pentyl N,N-diethylcarbamate (PubChem CID 71737047) has the molecular formula C25H43NO6S and a molecular weight of 485.69 g/mol. Its IUPAC name is 5-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]pentyl N,N-diethylcarbamate.
| Compound Name | 5-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]pentyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 71737047 |
| Molecular Formula | C25H43NO6S |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 5-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]pentyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCCCCCS[C@@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C25H43NO6S/c1-6-26(7-2)23(27)28-15-9-8-10-16-33-21-18(4)20-12-11-17(3)19-13-14-24(5)30-22(29-21)25(19,20)32-31-24/h17-22H,6-16H2,1-5H3/t17-,18-,19+,20+,21+,22-,24-,25-/m1/s1 |
| InChIKey | KOPNKQKJDWMEBP-BYQGFNPQSA-N |
| XLogP | 5.58 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|