C25H33FO6S — CID 140665297
3-[[(4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propyl 3-fluorobenzoate (PubChem CID 140665297) has the molecular formula C25H33FO6S and a molecular weight of 480.60 g/mol. Its IUPAC name is 3-[[(4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propyl 3-fluorobenzoate.
| Compound Name | 3-[[(4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propyl 3-fluorobenzoate |
|---|---|
| PubChem CID | 140665297 |
| Molecular Formula | C25H33FO6S |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[[(4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]propyl 3-fluorobenzoate |
| SMILES | C[C@H]1[C@H](SCCCOC(=O)c2cccc(F)c2)O[C@@H]2OC3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C25H33FO6S/c1-15-8-9-20-16(2)22(29-23-25(20)19(15)10-11-24(3,30-23)31-32-25)33-13-5-12-28-21(27)17-6-4-7-18(26)14-17/h4,6-7,14-16,19-20,22-23H,5,8-13H2,1-3H3/t15-,16-,19+,20+,22+,23-,24?,25-/m1/s1 |
| InChIKey | GZNTZHMMWREXLF-ATOYLJIMSA-N |
| XLogP | 5.31 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|