C26H36O6 — CID 177404686
ethyl (3S)-3-phenyl-3-[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoate (PubChem CID 177404686) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is ethyl (3S)-3-phenyl-3-[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoate.
| Compound Name | ethyl (3S)-3-phenyl-3-[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoate |
|---|---|
| PubChem CID | 177404686 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | ethyl (3S)-3-phenyl-3-[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propanoate |
| SMILES | CCOC(=O)C[C@@H](c1ccccc1)[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CCC([C@H]1C)C24OO3 |
| InChI | InChI=1S/C26H36O6/c1-5-28-22(27)15-19(18-9-7-6-8-10-18)23-17(3)21-12-11-16(2)20-13-14-25(4)30-24(29-23)26(20,21)32-31-25/h6-10,16-17,19-21,23-24H,5,11-15H2,1-4H3/t16-,17-,19+,20+,21?,23+,24-,25-,26?/m1/s1 |
| InChIKey | ZNLDSKNDMPNCST-UPIKSBRPSA-N |
| XLogP | 4.97 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|