C36H46N2O7 — CID 99934271
[(1S,4R,5R,8R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(4-benzhydrylpiperazin-1-yl)-4-oxobutanoate (PubChem CID 99934271) has the molecular formula C36H46N2O7 and a molecular weight of 618.77 g/mol. Its IUPAC name is [(1S,4R,5R,8R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(4-benzhydrylpiperazin-1-yl)-4-oxobutanoate.
| Compound Name | [(1S,4R,5R,8R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(4-benzhydrylpiperazin-1-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 99934271 |
| Molecular Formula | C36H46N2O7 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | [(1S,4R,5R,8R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(4-benzhydrylpiperazin-1-yl)-4-oxobutanoate |
| SMILES | C[C@H]1[C@@H](OC(=O)CCC(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)O[C@@H]2O[C@]3(C)CC[C@@H]4[C@H](C)CC[C@H]1[C@@]24OO3 |
| InChI | InChI=1S/C36H46N2O7/c1-24-14-15-29-25(2)33(42-34-36(29)28(24)18-19-35(3,43-34)44-45-36)41-31(40)17-16-30(39)37-20-22-38(23-21-37)32(26-10-6-4-7-11-26)27-12-8-5-9-13-27/h4-13,24-25,28-29,32-34H,14-23H2,1-3H3/t24-,25-,28-,29-,33+,34-,35+,36-/m1/s1 |
| InChIKey | CXEJHJXCKOQGRK-XYFDQZCYSA-N |
| XLogP | 5.45 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|