C30H42N2O8 — CID 99934319
[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutanoate (PubChem CID 99934319) has the molecular formula C30H42N2O8 and a molecular weight of 558.67 g/mol. Its IUPAC name is [(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutanoate.
| Compound Name | [(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 99934319 |
| Molecular Formula | C30H42N2O8 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | [(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutanoate |
| SMILES | COc1ccc(N2CCN(C(=O)CCC(=O)O[C@@H]3O[C@@H]4O[C@]5(C)CC[C@H]6[C@H](C)CC[C@@H]([C@H]3C)[C@@]46OO5)CC2)cc1 |
| InChI | InChI=1S/C30H42N2O8/c1-19-5-10-24-20(2)27(37-28-30(24)23(19)13-14-29(3,38-28)39-40-30)36-26(34)12-11-25(33)32-17-15-31(16-18-32)21-6-8-22(35-4)9-7-21/h6-9,19-20,23-24,27-28H,5,10-18H2,1-4H3/t19-,20-,23+,24+,27-,28-,29+,30-/m1/s1 |
| InChIKey | AXISLXOLACSPOR-UJKDZDEISA-N |
| XLogP | 3.88 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|