C29H37NO10 — CID 10918735
4-O-[cyano-(2,4-dimethoxyphenyl)methyl] 1-O-[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate (PubChem CID 10918735) has the molecular formula C29H37NO10 and a molecular weight of 559.61 g/mol. Its IUPAC name is 4-O-[cyano-(2,4-dimethoxyphenyl)methyl] 1-O-[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate.
| Compound Name | 4-O-[cyano-(2,4-dimethoxyphenyl)methyl] 1-O-[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
|---|---|
| PubChem CID | 10918735 |
| Molecular Formula | C29H37NO10 |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 4-O-[cyano-(2,4-dimethoxyphenyl)methyl] 1-O-[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
| SMILES | COc1ccc(C(C#N)OC(=O)CCC(=O)O[C@@H]2O[C@@H]3O[C@]4(C)CCC5[C@H](C)CCC([C@H]2C)[C@]53OO4)c(OC)c1 |
| InChI | InChI=1S/C29H37NO10/c1-16-6-9-21-17(2)26(37-27-29(21)20(16)12-13-28(3,38-27)39-40-29)36-25(32)11-10-24(31)35-23(15-30)19-8-7-18(33-4)14-22(19)34-5/h7-8,14,16-17,20-21,23,26-27H,6,9-13H2,1-5H3/t16-,17-,20?,21?,23?,26-,27-,28+,29-/m1/s1 |
| InChIKey | SXSFVZHPUSASDA-VCIFELMQSA-N |
| XLogP | 4.34 |
| TPSA | 131.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|