C27H32BrNO8 — CID 11071947
4-O-[(4-bromophenyl)-cyanomethyl] 1-O-[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate (PubChem CID 11071947) has the molecular formula C27H32BrNO8 and a molecular weight of 578.46 g/mol. Its IUPAC name is 4-O-[(4-bromophenyl)-cyanomethyl] 1-O-[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate.
| Compound Name | 4-O-[(4-bromophenyl)-cyanomethyl] 1-O-[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
|---|---|
| PubChem CID | 11071947 |
| Molecular Formula | C27H32BrNO8 |
| Molecular Weight | 578.46 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | 4-O-[(4-bromophenyl)-cyanomethyl] 1-O-[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](OC(=O)CCC(=O)OC(C#N)c3ccc(Br)cc3)O[C@@H]3O[C@]4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C27H32BrNO8/c1-15-4-9-20-16(2)24(34-25-27(20)19(15)12-13-26(3,35-25)36-37-27)33-23(31)11-10-22(30)32-21(14-29)17-5-7-18(28)8-6-17/h5-8,15-16,19-21,24-25H,4,9-13H2,1-3H3/t15-,16-,19?,20?,21?,24-,25-,26+,27-/m1/s1 |
| InChIKey | HKFSOALXJZEFHI-MUGBLMPISA-N |
| XLogP | 5.09 |
| TPSA | 113.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|